C21H24FN3O — CID 18833140
N-butyl-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18833140) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is N-butyl-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-butyl-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18833140 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-butyl-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | CCCCNC(=O)CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C21H24FN3O/c1-2-3-12-24-20(26)9-6-7-16-17-14-15(22)10-11-18(17)25-21(16)19-8-4-5-13-23-19/h4-5,8,10-11,13-14,25H,2-3,6-7,9,12H2,1H3,(H,24,26) |
| InChIKey | UTTNFDHDQHTPJP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|