C24H31N3O3 — CID 18832841
N,N-bis(2-methoxyethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18832841) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N,N-bis(2-methoxyethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18832841 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | COCCN(CCOC)C(=O)CCCc1c(-c2ccccn2)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C24H31N3O3/c1-18-10-11-21-20(17-18)19(24(26-21)22-8-4-5-12-25-22)7-6-9-23(28)27(13-15-29-2)14-16-30-3/h4-5,8,10-12,17,26H,6-7,9,13-16H2,1-3H3 |
| InChIKey | ZKRUZOXRYWKQDO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|