C28H24N2O2 — CID 18832833
naphthalen-1-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate (PubChem CID 18832833) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is naphthalen-1-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate.
| Compound Name | naphthalen-1-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 18832833 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | naphthalen-1-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)Oc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C28H24N2O2/c1-19-15-16-24-23(18-19)22(28(30-24)25-12-4-5-17-29-25)11-7-14-27(31)32-26-13-6-9-20-8-2-3-10-21(20)26/h2-6,8-10,12-13,15-18,30H,7,11,14H2,1H3 |
| InChIKey | UOFDXDSVRUDTFM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|