C27H23N3O2 — CID 18832842
quinolin-8-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate (PubChem CID 18832842) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is quinolin-8-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate.
| Compound Name | quinolin-8-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 18832842 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | quinolin-8-yl 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoate |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)Oc3cccc4cccnc34)c2c1 |
| InChI | InChI=1S/C27H23N3O2/c1-18-13-14-22-21(17-18)20(27(30-22)23-10-2-3-15-28-23)9-5-12-25(31)32-24-11-4-7-19-8-6-16-29-26(19)24/h2-4,6-8,10-11,13-17,30H,5,9,12H2,1H3 |
| InChIKey | SUSWESMWQPHVEX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|