C26H27N3O — CID 18832831
N-benzyl-N-methyl-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18832831) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-benzyl-N-methyl-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18832831 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-benzyl-N-methyl-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)N(C)Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H27N3O/c1-19-14-15-23-22(17-19)21(26(28-23)24-12-6-7-16-27-24)11-8-13-25(30)29(2)18-20-9-4-3-5-10-20/h3-7,9-10,12,14-17,28H,8,11,13,18H2,1-2H3 |
| InChIKey | ZNZONJPKQRZCNA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|