C21H20N2O2S — CID 9034569
N-(furan-2-ylmethyl)-3-(5-methyl-2-thiophen-2-yl-1H-indol-3-yl)propanamide (PubChem CID 9034569) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(5-methyl-2-thiophen-2-yl-1H-indol-3-yl)propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-(5-methyl-2-thiophen-2-yl-1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 9034569 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(5-methyl-2-thiophen-2-yl-1H-indol-3-yl)propanamide |
| SMILES | Cc1ccc2[nH]c(-c3cccs3)c(CCC(=O)NCc3ccco3)c2c1 |
| InChI | InChI=1S/C21H20N2O2S/c1-14-6-8-18-17(12-14)16(21(23-18)19-5-3-11-26-19)7-9-20(24)22-13-15-4-2-10-25-15/h2-6,8,10-12,23H,7,9,13H2,1H3,(H,22,24) |
| InChIKey | FURVPOLCOHVSBJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|