C15H19NO2S — CID 124510383
4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)butanamide (PubChem CID 124510383) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)butanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 124510383 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)butanamide |
| SMILES | Cc1cc(CCCC(=O)NCc2ccco2)c(C)s1 |
| InChI | InChI=1S/C15H19NO2S/c1-11-9-13(12(2)19-11)5-3-7-15(17)16-10-14-6-4-8-18-14/h4,6,8-9H,3,5,7,10H2,1-2H3,(H,16,17) |
| InChIKey | NJQLXFUMYXZSFW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |