C12H18N2O3 — CID 4024516
N'-(furan-2-ylmethyl)-N-propylbutanediamide (PubChem CID 4024516) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N-propylbutanediamide.
| Compound Name | N'-(furan-2-ylmethyl)-N-propylbutanediamide |
|---|---|
| PubChem CID | 4024516 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N-propylbutanediamide |
| SMILES | CCCNC(=O)CCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H18N2O3/c1-2-7-13-11(15)5-6-12(16)14-9-10-4-3-8-17-10/h3-4,8H,2,5-7,9H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | SSDBUSGLGQAIBM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |