C28H23ClFN3O — CID 18847315
N-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18847315) has the molecular formula C28H23ClFN3O and a molecular weight of 471.96 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18847315 |
| Molecular Formula | C28H23ClFN3O |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12)NCc1ccccc1Cl |
| InChI | InChI=1S/C28H23ClFN3O/c29-23-9-3-1-7-19(23)17-31-27(34)11-5-8-21-22-16-20(30)13-15-25(22)33-28(21)26-14-12-18-6-2-4-10-24(18)32-26/h1-4,6-7,9-10,12-16,33H,5,8,11,17H2,(H,31,34) |
| InChIKey | VURMUCVBEBADRH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|