C28H20FN3OS2 — CID 18847457
S-(1,3-benzothiazol-2-yl) 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanethioate (PubChem CID 18847457) has the molecular formula C28H20FN3OS2 and a molecular weight of 497.62 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanethioate |
|---|---|
| PubChem CID | 18847457 |
| Molecular Formula | C28H20FN3OS2 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanethioate |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H20FN3OS2/c29-18-13-15-22-20(16-18)19(27(31-22)24-14-12-17-6-1-2-8-21(17)30-24)7-5-11-26(33)35-28-32-23-9-3-4-10-25(23)34-28/h1-4,6,8-10,12-16,31H,5,7,11H2 |
| InChIKey | DGSIZMAREINORC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|