C27H28FN3O — CID 18847310
4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-1-(4-methylpiperidin-1-yl)butan-1-one (PubChem CID 18847310) has the molecular formula C27H28FN3O and a molecular weight of 429.54 g/mol. Its IUPAC name is 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-1-(4-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-1-(4-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 18847310 |
| Molecular Formula | C27H28FN3O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-1-(4-methylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CCN(C(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C27H28FN3O/c1-18-13-15-31(16-14-18)26(32)8-4-6-21-22-17-20(28)10-12-24(22)30-27(21)25-11-9-19-5-2-3-7-23(19)29-25/h2-3,5,7,9-12,17-18,30H,4,6,8,13-16H2,1H3 |
| InChIKey | BGFMPSBZZLYVTH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|