C28H22Cl2N2O2 — CID 18847123
(2,4-dichlorophenyl) 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoate (PubChem CID 18847123) has the molecular formula C28H22Cl2N2O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoate.
| Compound Name | (2,4-dichlorophenyl) 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 18847123 |
| Molecular Formula | C28H22Cl2N2O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (2,4-dichlorophenyl) 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoate |
| SMILES | Cc1ccc2[nH]c(-c3ccc4ccccc4n3)c(CCCC(=O)Oc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C28H22Cl2N2O2/c1-17-9-12-24-21(15-17)20(6-4-8-27(33)34-26-14-11-19(29)16-22(26)30)28(32-24)25-13-10-18-5-2-3-7-23(18)31-25/h2-3,5,7,9-16,32H,4,6,8H2,1H3 |
| InChIKey | RQTGIDONUWHVNR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|