C28H25N3O2 — CID 18846841
N-(3-methoxyphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846841) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(3-methoxyphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18846841 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-(3-methoxyphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | COc1cccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C28H25N3O2/c1-33-21-10-6-9-20(18-21)29-27(32)15-7-12-23-22-11-3-5-14-25(22)31-28(23)26-17-16-19-8-2-4-13-24(19)30-26/h2-6,8-11,13-14,16-18,31H,7,12,15H2,1H3,(H,29,32) |
| InChIKey | WTDRGDORJKBAOX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|