C28H23N5O4 — CID 18846924
4-nitro-N'-[4-(2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide (PubChem CID 18846924) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 4-nitro-N'-[4-(2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[4-(2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 18846924 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-nitro-N'-[4-(2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccccc12)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H23N5O4/c34-26(31-32-28(35)19-12-15-20(16-13-19)33(36)37)11-5-8-22-21-7-2-4-10-24(21)30-27(22)25-17-14-18-6-1-3-9-23(18)29-25/h1-4,6-7,9-10,12-17,30H,5,8,11H2,(H,31,34)(H,32,35) |
| InChIKey | RZUGUQXDAQVBFL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|