C25H21FN2O3 — CID 8869378
N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanamide (PubChem CID 8869378) has the molecular formula C25H21FN2O3 and a molecular weight of 416.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanamide |
|---|---|
| PubChem CID | 8869378 |
| Molecular Formula | C25H21FN2O3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanamide |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)[nH]c2ccccc12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H21FN2O3/c26-18-8-6-17(7-9-18)25-20(19-3-1-2-4-21(19)28-25)10-12-24(29)27-14-16-5-11-22-23(13-16)31-15-30-22/h1-9,11,13,28H,10,12,14-15H2,(H,27,29) |
| InChIKey | WMFSDKIUJDEURB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |