C22H18F2N2O2 — CID 166184600
3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-(furan-3-ylmethyl)propanamide (PubChem CID 166184600) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-(furan-3-ylmethyl)propanamide.
| Compound Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-(furan-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 166184600 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-(furan-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)[nH]c2ccc(F)cc12)NCc1ccoc1 |
| InChI | InChI=1S/C22H18F2N2O2/c23-16-3-1-15(2-4-16)22-18(19-11-17(24)5-7-20(19)26-22)6-8-21(27)25-12-14-9-10-28-13-14/h1-5,7,9-11,13,26H,6,8,12H2,(H,25,27) |
| InChIKey | QEOKGJOIASFMFA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |