C23H27F2N3O — CID 8865731
N-[2-(diethylamino)ethyl]-3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]propanamide (PubChem CID 8865731) has the molecular formula C23H27F2N3O and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]propanamide |
|---|---|
| PubChem CID | 8865731 |
| Molecular Formula | C23H27F2N3O |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]propanamide |
| SMILES | CCN(CC)CCNC(=O)CCc1c(-c2ccc(F)cc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H27F2N3O/c1-3-28(4-2)14-13-26-22(29)12-10-19-20-15-18(25)9-11-21(20)27-23(19)16-5-7-17(24)8-6-16/h5-9,11,15,27H,3-4,10,12-14H2,1-2H3,(H,26,29) |
| InChIKey | ZUHOOVVNOAZDQI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |