C20H19F2N3O2 — CID 17392425
3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-(methylamino)-2-oxoethyl]propanamide (PubChem CID 17392425) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-(methylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-(methylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 17392425 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-(methylamino)-2-oxoethyl]propanamide |
| SMILES | CNC(=O)CNC(=O)CCc1c(-c2ccc(F)cc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H19F2N3O2/c1-23-19(27)11-24-18(26)9-7-15-16-10-14(22)6-8-17(16)25-20(15)12-2-4-13(21)5-3-12/h2-6,8,10,25H,7,9,11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OKGFILBEYHQZML-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |