C25H24FN3O3S — CID 46463974
3-(5-fluoro-2-phenyl-1H-indol-3-yl)-N-[[4-(methylsulfamoyl)phenyl]methyl]propanamide (PubChem CID 46463974) has the molecular formula C25H24FN3O3S and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-(5-fluoro-2-phenyl-1H-indol-3-yl)-N-[[4-(methylsulfamoyl)phenyl]methyl]propanamide.
| Compound Name | 3-(5-fluoro-2-phenyl-1H-indol-3-yl)-N-[[4-(methylsulfamoyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 46463974 |
| Molecular Formula | C25H24FN3O3S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 3-(5-fluoro-2-phenyl-1H-indol-3-yl)-N-[[4-(methylsulfamoyl)phenyl]methyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)CCc2c(-c3ccccc3)[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C25H24FN3O3S/c1-27-33(31,32)20-10-7-17(8-11-20)16-28-24(30)14-12-21-22-15-19(26)9-13-23(22)29-25(21)18-5-3-2-4-6-18/h2-11,13,15,27,29H,12,14,16H2,1H3,(H,28,30) |
| InChIKey | FUAIDDQYPYZRSP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |