C22H23FN2O3 — CID 119228674
3-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl-methylamino]-2-methylpropanoic acid (PubChem CID 119228674) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119228674 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)CCc1c(-c2ccccc2)[nH]c2ccc(F)cc12)C(=O)O |
| InChI | InChI=1S/C22H23FN2O3/c1-14(22(27)28)13-25(2)20(26)11-9-17-18-12-16(23)8-10-19(18)24-21(17)15-6-4-3-5-7-15/h3-8,10,12,14,24H,9,11,13H2,1-2H3,(H,27,28) |
| InChIKey | JJPTZZAOJKQCON-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |