C23H26F2N2O3 — CID 8533693
3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide (PubChem CID 8533693) has the molecular formula C23H26F2N2O3 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide.
| Compound Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 8533693 |
| Molecular Formula | C23H26F2N2O3 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-[5-fluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide |
| SMILES | COCCOCCCNC(=O)CCc1c(-c2ccc(F)cc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H26F2N2O3/c1-29-13-14-30-12-2-11-26-22(28)10-8-19-20-15-18(25)7-9-21(20)27-23(19)16-3-5-17(24)6-4-16/h3-7,9,15,27H,2,8,10-14H2,1H3,(H,26,28) |
| InChIKey | MMJZWEBGJQAKHQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|