C18H15ClN2O3 — CID 113204704
N-(1,3-benzodioxol-5-ylmethyl)-5-chloro-3-methyl-1H-indole-2-carboxamide (PubChem CID 113204704) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-chloro-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-chloro-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204704 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-chloro-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc3c(c2)OCO3)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H15ClN2O3/c1-10-13-7-12(19)3-4-14(13)21-17(10)18(22)20-8-11-2-5-15-16(6-11)24-9-23-15/h2-7,21H,8-9H2,1H3,(H,20,22) |
| InChIKey | FKJKAWLKFZCPSQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|