C22H21ClN4O4 — CID 42570456
N-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42570456) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42570456 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(CNC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H21ClN4O4/c23-14-2-3-17-16(8-14)15-5-6-27(11-18(15)26-17)22(29)25-10-21(28)24-9-13-1-4-19-20(7-13)31-12-30-19/h1-4,7-8,26H,5-6,9-12H2,(H,24,28)(H,25,29) |
| InChIKey | RFMYSQKREZAEBC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|