C20H19Cl2N3O — CID 146387922
2-amino-3-(4-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one (PubChem CID 146387922) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one.
| Compound Name | 2-amino-3-(4-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 146387922 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
| SMILES | NC(Cc1ccc(Cl)cc1)C(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H19Cl2N3O/c21-13-3-1-12(2-4-13)9-17(23)20(26)25-8-7-15-16-10-14(22)5-6-18(16)24-19(15)11-25/h1-6,10,17,24H,7-9,11,23H2 |
| InChIKey | ZIXVMIZMSMDTMX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|