C20H20Cl2N3O+ — CID 153405346
[(2R)-3-(2-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-oxopropan-2-yl]azanium (PubChem CID 153405346) has the molecular formula C20H20Cl2N3O+ and a molecular weight of 389.31 g/mol. Its IUPAC name is [(2R)-3-(2-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-oxopropan-2-yl]azanium.
| Compound Name | [(2R)-3-(2-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 153405346 |
| Molecular Formula | C20H20Cl2N3O+ |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(2R)-3-(2-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-oxopropan-2-yl]azanium |
| SMILES | [NH3+][C@H](Cc1ccccc1Cl)C(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H19Cl2N3O/c21-13-5-6-18-15(10-13)14-7-8-25(11-19(14)24-18)20(26)17(23)9-12-3-1-2-4-16(12)22/h1-6,10,17,24H,7-9,11,23H2/p+1/t17-/m1/s1 |
| InChIKey | NYODPNVUWONLJZ-QGZVFWFLSA-O |
| XLogP | 3.21 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|