C19H14ClF3N2O2 — CID 146387755
(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[3-hydroxy-4-(trifluoromethyl)phenyl]methanone (PubChem CID 146387755) has the molecular formula C19H14ClF3N2O2 and a molecular weight of 394.78 g/mol. Its IUPAC name is (6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[3-hydroxy-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[3-hydroxy-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 146387755 |
| Molecular Formula | C19H14ClF3N2O2 |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[3-hydroxy-4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)c(O)c1)N1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C19H14ClF3N2O2/c20-11-2-4-15-13(8-11)12-5-6-25(9-16(12)24-15)18(27)10-1-3-14(17(26)7-10)19(21,22)23/h1-4,7-8,24,26H,5-6,9H2 |
| InChIKey | QMFLYZYFZOTGLY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|