C23H23Cl2N3O3S — CID 55931181
(4-chloro-3-piperidin-1-ylsulfonylphenyl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 55931181) has the molecular formula C23H23Cl2N3O3S and a molecular weight of 492.43 g/mol. Its IUPAC name is (4-chloro-3-piperidin-1-ylsulfonylphenyl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (4-chloro-3-piperidin-1-ylsulfonylphenyl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 55931181 |
| Molecular Formula | C23H23Cl2N3O3S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | (4-chloro-3-piperidin-1-ylsulfonylphenyl)-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C23H23Cl2N3O3S/c24-16-5-7-20-17(13-16)18-14-27(11-8-21(18)26-20)23(29)15-4-6-19(25)22(12-15)32(30,31)28-9-2-1-3-10-28/h4-7,12-13,26H,1-3,8-11,14H2 |
| InChIKey | XLASULNDPKIYCT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|