C20H22ClN3O4S — CID 55931313
N-tert-butyl-5-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)furan-2-sulfonamide (PubChem CID 55931313) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-tert-butyl-5-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)furan-2-sulfonamide.
| Compound Name | N-tert-butyl-5-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 55931313 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-tert-butyl-5-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)furan-2-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)o1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-20(2,3)23-29(26,27)18-7-6-17(28-18)19(25)24-9-8-16-14(11-24)13-10-12(21)4-5-15(13)22-16/h4-7,10,22-23H,8-9,11H2,1-3H3 |
| InChIKey | VGSAWKLUJXYUQM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|