C20H17ClN4O2 — CID 70741965
(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(imidazol-1-ylmethyl)furan-2-yl]methanone (PubChem CID 70741965) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(imidazol-1-ylmethyl)furan-2-yl]methanone.
| Compound Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(imidazol-1-ylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 70741965 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(imidazol-1-ylmethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(Cn2ccnc2)o1)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C20H17ClN4O2/c21-13-1-3-17-15(9-13)16-11-25(7-5-18(16)23-17)20(26)19-4-2-14(27-19)10-24-8-6-22-12-24/h1-4,6,8-9,12,23H,5,7,10-11H2 |
| InChIKey | KGEIUXOSNSTLHX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|