C13H13ClN2O2 — CID 90294086
9-chloro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylic acid (PubChem CID 90294086) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 9-chloro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylic acid.
| Compound Name | 9-chloro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90294086 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 9-chloro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylic acid |
| SMILES | O=C(O)N1CCCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-8-3-4-12-9(6-8)10-7-16(13(17)18)5-1-2-11(10)15-12/h3-4,6,15H,1-2,5,7H2,(H,17,18) |
| InChIKey | BIWGOWZEOOKTBJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|