C19H17ClN4O2 — CID 126810024
N-(4-carbamoylphenyl)-8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 126810024) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 126810024 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(4-carbamoylphenyl)-8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)cc1 |
| InChI | InChI=1S/C19H17ClN4O2/c20-12-3-6-16-14(9-12)15-10-24(8-7-17(15)23-16)19(26)22-13-4-1-11(2-5-13)18(21)25/h1-6,9,23H,7-8,10H2,(H2,21,25)(H,22,26) |
| InChIKey | SYQKNUJXQPGYIE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|