C20H24ClN5O — CID 87038734
8-chloro-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 87038734) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is 8-chloro-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 8-chloro-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 87038734 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 8-chloro-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | Cc1nn(C)c(C)c1CCNC(=O)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C20H24ClN5O/c1-12-15(13(2)25(3)24-12)6-8-22-20(27)26-9-7-19-17(11-26)16-10-14(21)4-5-18(16)23-19/h4-5,10,23H,6-9,11H2,1-3H3,(H,22,27) |
| InChIKey | ISJOYISLBHNRJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|