C17H17ClN4O — CID 87036837
(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-ethyl-1H-pyrazol-3-yl)methanone (PubChem CID 87036837) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-ethyl-1H-pyrazol-3-yl)methanone.
| Compound Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-ethyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 87036837 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-ethyl-1H-pyrazol-3-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCc3[nH]c4ccc(Cl)cc4c3C2)n[nH]1 |
| InChI | InChI=1S/C17H17ClN4O/c1-2-11-8-16(21-20-11)17(23)22-6-5-15-13(9-22)12-7-10(18)3-4-14(12)19-15/h3-4,7-8,19H,2,5-6,9H2,1H3,(H,20,21) |
| InChIKey | PNPBSEYVXCAARP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|