C27H26N2O — CID 141122674
[4-(4-ethylphenyl)phenyl]-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 141122674) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-(4-ethylphenyl)phenyl]-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [4-(4-ethylphenyl)phenyl]-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 141122674 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [4-(4-ethylphenyl)phenyl]-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | CCc1ccc(-c2ccc(C(=O)N3CCc4[nH]c5ccc(C)cc5c4C3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O/c1-3-19-5-7-20(8-6-19)21-9-11-22(12-10-21)27(30)29-15-14-26-24(17-29)23-16-18(2)4-13-25(23)28-26/h4-13,16,28H,3,14-15,17H2,1-2H3 |
| InChIKey | VATFPXOEEXWCCA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|