C21H19N3O3 — CID 32852711
7-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 32852711) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 7-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 32852711 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 7-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C(=O)c1ccc2c(c1)OCC(=O)N2)CC3 |
| InChI | InChI=1S/C21H19N3O3/c1-12-2-4-16-14(8-12)15-10-24(7-6-17(15)22-16)21(26)13-3-5-18-19(9-13)27-11-20(25)23-18/h2-5,8-9,22H,6-7,10-11H2,1H3,(H,23,25) |
| InChIKey | QNOJTQOQZIPJEG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|