C21H20N2O3 — CID 113081838
2-(3,4-dimethylbenzoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 113081838) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(3,4-dimethylbenzoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-(3,4-dimethylbenzoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 113081838 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(3,4-dimethylbenzoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N2CCc3[nH]c4ccc(C(=O)O)cc4c3C2)cc1C |
| InChI | InChI=1S/C21H20N2O3/c1-12-3-4-14(9-13(12)2)20(24)23-8-7-19-17(11-23)16-10-15(21(25)26)5-6-18(16)22-19/h3-6,9-10,22H,7-8,11H2,1-2H3,(H,25,26) |
| InChIKey | MCOFHSZZWFPEDE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|