C21H21N3O5S — CID 75414304
2-[4-(dimethylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 75414304) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-[4-(dimethylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 75414304 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)N2CCc3[nH]c4ccc(C(=O)O)cc4c3C2)cc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-23(2)30(28,29)15-6-3-13(4-7-15)20(25)24-10-9-19-17(12-24)16-11-14(21(26)27)5-8-18(16)22-19/h3-8,11,22H,9-10,12H2,1-2H3,(H,26,27) |
| InChIKey | HWTFWENRYTVKSX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|