C26H23N3O5S — CID 32758204
methyl 2-[4-(phenylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 32758204) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is methyl 2-[4-(phenylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[4-(phenylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 32758204 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | methyl 2-[4-(phenylsulfamoyl)benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1)CC3 |
| InChI | InChI=1S/C26H23N3O5S/c1-34-26(31)18-9-12-23-21(15-18)22-16-29(14-13-24(22)27-23)25(30)17-7-10-20(11-8-17)35(32,33)28-19-5-3-2-4-6-19/h2-12,15,27-28H,13-14,16H2,1H3 |
| InChIKey | FAEWQLCPRGNDMR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|