C18H16N2O3S — CID 32757347
methyl 2-(thiophene-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 32757347) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 2-(thiophene-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-(thiophene-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 32757347 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 2-(thiophene-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)c1cccs1)CC3 |
| InChI | InChI=1S/C18H16N2O3S/c1-23-18(22)11-4-5-14-12(9-11)13-10-20(7-6-15(13)19-14)17(21)16-3-2-8-24-16/h2-5,8-9,19H,6-7,10H2,1H3 |
| InChIKey | NHBDMXWZEVYNFJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|