C20H20N2O2S — CID 30858260
1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 30858260) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 30858260 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C(=O)CCC(=O)c1cccs1)CC3 |
| InChI | InChI=1S/C20H20N2O2S/c1-13-4-5-16-14(11-13)15-12-22(9-8-17(15)21-16)20(24)7-6-18(23)19-3-2-10-25-19/h2-5,10-11,21H,6-9,12H2,1H3 |
| InChIKey | PVZTYLHAFXVDQV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|