C20H19FN2O — CID 113089232
1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone (PubChem CID 113089232) has the molecular formula C20H19FN2O and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 113089232 |
| Molecular Formula | C20H19FN2O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(CC(=O)N2CCc3[nH]c4ccc(F)cc4c3C2)c1 |
| InChI | InChI=1S/C20H19FN2O/c1-13-3-2-4-14(9-13)10-20(24)23-8-7-19-17(12-23)16-11-15(21)5-6-18(16)22-19/h2-6,9,11,22H,7-8,10,12H2,1H3 |
| InChIKey | MVTDKCNCFANETF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|