C21H22N2O2 — CID 113089341
1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone (PubChem CID 113089341) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 113089341 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-methylphenyl)ethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)Cc1cccc(C)c1)CC3 |
| InChI | InChI=1S/C21H22N2O2/c1-14-4-3-5-15(10-14)11-21(24)23-9-8-20-18(13-23)17-12-16(25-2)6-7-19(17)22-20/h3-7,10,12,22H,8-9,11,13H2,1-2H3 |
| InChIKey | RMFXILDAJCPCEG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|