C23H25N3O4 — CID 45490738
N-(2-methoxyphenyl)-4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutanamide (PubChem CID 45490738) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutanamide.
| Compound Name | N-(2-methoxyphenyl)-4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 45490738 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(2-methoxyphenyl)-4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)CCC(=O)Nc1ccccc1OC)CC3 |
| InChI | InChI=1S/C23H25N3O4/c1-29-15-7-8-18-16(13-15)17-14-26(12-11-19(17)24-18)23(28)10-9-22(27)25-20-5-3-4-6-21(20)30-2/h3-8,13,24H,9-12,14H2,1-2H3,(H,25,27) |
| InChIKey | BXSHCPNGUSLWCS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|