C19H16BrFN2O — CID 113089718
2-(3-bromophenyl)-1-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 113089718) has the molecular formula C19H16BrFN2O and a molecular weight of 387.25 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 113089718 |
| Molecular Formula | C19H16BrFN2O |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-(3-bromophenyl)-1-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(Cc1cccc(Br)c1)N1CCc2[nH]c3cc(F)ccc3c2C1 |
| InChI | InChI=1S/C19H16BrFN2O/c20-13-3-1-2-12(8-13)9-19(24)23-7-6-17-16(11-23)15-5-4-14(21)10-18(15)22-17/h1-5,8,10,22H,6-7,9,11H2 |
| InChIKey | IWZKRUNVYVFJEM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|