C20H18BrFN2O — CID 32856310
1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3-fluorophenyl)propan-1-one (PubChem CID 32856310) has the molecular formula C20H18BrFN2O and a molecular weight of 401.28 g/mol. Its IUPAC name is 1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3-fluorophenyl)propan-1-one.
| Compound Name | 1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 32856310 |
| Molecular Formula | C20H18BrFN2O |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1cccc(F)c1)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C20H18BrFN2O/c21-14-5-6-18-16(11-14)17-12-24(9-8-19(17)23-18)20(25)7-4-13-2-1-3-15(22)10-13/h1-3,5-6,10-11,23H,4,7-9,12H2 |
| InChIKey | NISJNBYZGOCBEO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|