C24H27BrN4O — CID 30863873
2-(4-benzylpiperazin-1-yl)-1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 30863873) has the molecular formula C24H27BrN4O and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 30863873 |
| Molecular Formula | C24H27BrN4O |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-1-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C24H27BrN4O/c25-19-6-7-22-20(14-19)21-16-29(9-8-23(21)26-22)24(30)17-28-12-10-27(11-13-28)15-18-4-2-1-3-5-18/h1-7,14,26H,8-13,15-17H2 |
| InChIKey | ROGZNHJQUBJMFA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|