C19H24N4O2 — CID 933647
1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperidine-4-carboxamide (PubChem CID 933647) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 933647 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC(=O)N2CCc3[nH]c4ccccc4c3C2)CC1 |
| InChI | InChI=1S/C19H24N4O2/c20-19(25)13-5-8-22(9-6-13)12-18(24)23-10-7-17-15(11-23)14-3-1-2-4-16(14)21-17/h1-4,13,21H,5-12H2,(H2,20,25) |
| InChIKey | ZDOCUQFRNAKBIY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|