C25H35N5O2 — CID 86889631
N-cyclopentyl-2-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]propanamide (PubChem CID 86889631) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]propanamide.
| Compound Name | N-cyclopentyl-2-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 86889631 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-cyclopentyl-2-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC1CCCC1)N1CCN(CC(=O)N2CCc3[nH]c4ccccc4c3C2)CC1 |
| InChI | InChI=1S/C25H35N5O2/c1-18(25(32)26-19-6-2-3-7-19)29-14-12-28(13-15-29)17-24(31)30-11-10-23-21(16-30)20-8-4-5-9-22(20)27-23/h4-5,8-9,18-19,27H,2-3,6-7,10-17H2,1H3,(H,26,32) |
| InChIKey | OGEUNFHIVPUUQI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|