C27H32N4O2 — CID 86874951
1-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]-4-phenylbutan-1-one (PubChem CID 86874951) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 86874951 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[4-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]piperazin-1-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCN(CC(=O)N2CCc3[nH]c4ccccc4c3C2)CC1 |
| InChI | InChI=1S/C27H32N4O2/c32-26(12-6-9-21-7-2-1-3-8-21)30-17-15-29(16-18-30)20-27(33)31-14-13-25-23(19-31)22-10-4-5-11-24(22)28-25/h1-5,7-8,10-11,28H,6,9,12-20H2 |
| InChIKey | PISYGFUAUKSOJS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|