C23H23N3O — CID 17467441
4-(1H-indol-3-yl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-1-one (PubChem CID 17467441) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-1-one.
| Compound Name | 4-(1H-indol-3-yl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 17467441 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(1H-indol-3-yl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H23N3O/c27-23(11-5-6-16-14-24-20-9-3-1-7-17(16)20)26-13-12-22-19(15-26)18-8-2-4-10-21(18)25-22/h1-4,7-10,14,24-25H,5-6,11-13,15H2 |
| InChIKey | BDIIFNIORWKEDJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|